C23H23F2N7O — CID 58110142
(7R,9R)-2-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)anilino]-9-(4-fluorophenyl)-7-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-a]azepin-7-ol (PubChem CID 58110142) has the molecular formula C23H23F2N7O and a molecular weight of 451.48 g/mol. Its IUPAC name is (7R,9R)-2-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)anilino]-9-(4-fluorophenyl)-7-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-a]azepin-7-ol.
| Compound Name | (7R,9R)-2-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)anilino]-9-(4-fluorophenyl)-7-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-a]azepin-7-ol |
|---|---|
| PubChem CID | 58110142 |
| Molecular Formula | C23H23F2N7O |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (7R,9R)-2-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)anilino]-9-(4-fluorophenyl)-7-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-a]azepin-7-ol |
| SMILES | Cc1ncn(-c2ccc(Nc3nc4n(n3)CC[C@](C)(O)C[C@@H]4c3ccc(F)cc3)cc2F)n1 |
| InChI | InChI=1S/C23H23F2N7O/c1-14-26-13-32(29-14)20-8-7-17(11-19(20)25)27-22-28-21-18(15-3-5-16(24)6-4-15)12-23(2,33)9-10-31(21)30-22/h3-8,11,13,18,33H,9-10,12H2,1-2H3,(H,27,30)/t18-,23+/m1/s1 |
| InChIKey | MYLDCIRDCDQPIP-JPYJTQIMSA-N |
| XLogP | 3.87 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |