C24H23F3N8 — CID 139415535
7-(2,4-difluorophenyl)-2-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N,5,5-trimethyl-6H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 139415535) has the molecular formula C24H23F3N8 and a molecular weight of 480.50 g/mol. Its IUPAC name is 7-(2,4-difluorophenyl)-2-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N,5,5-trimethyl-6H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 7-(2,4-difluorophenyl)-2-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N,5,5-trimethyl-6H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 139415535 |
| Molecular Formula | C24H23F3N8 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 7-(2,4-difluorophenyl)-2-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N,5,5-trimethyl-6H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(-n3cnc(C)n3)c(F)c2)nc2c1C(C)(C)CN2c1ccc(F)cc1F |
| InChI | InChI=1S/C24H23F3N8/c1-13-29-12-35(33-13)19-8-6-15(10-17(19)27)30-23-31-21(28-4)20-22(32-23)34(11-24(20,2)3)18-7-5-14(25)9-16(18)26/h5-10,12H,11H2,1-4H3,(H2,28,30,31,32) |
| InChIKey | KYESVJIRUQPQIX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |