C24H23F2N7O — CID 58075630
(7R)-7-(2,4-difluorophenyl)-2-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-diamine (PubChem CID 58075630) has the molecular formula C24H23F2N7O and a molecular weight of 463.49 g/mol. Its IUPAC name is (7R)-7-(2,4-difluorophenyl)-2-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-diamine.
| Compound Name | (7R)-7-(2,4-difluorophenyl)-2-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58075630 |
| Molecular Formula | C24H23F2N7O |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (7R)-7-(2,4-difluorophenyl)-2-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(-n3cnc(C)n3)c(OC)c2)nc2c1CC[C@@H]2c1ccc(F)cc1F |
| InChI | InChI=1S/C24H23F2N7O/c1-13-28-12-33(32-13)20-9-5-15(11-21(20)34-3)29-24-30-22-17(7-8-18(22)23(27-2)31-24)16-6-4-14(25)10-19(16)26/h4-6,9-12,17H,7-8H2,1-3H3,(H2,27,29,30,31)/t17-/m1/s1 |
| InChIKey | UVMGCXNZRIZVBS-QGZVFWFLSA-N |
| XLogP | 4.52 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |