C25H26FN7O — CID 58075739
(7R)-7-(4-fluorophenyl)-2-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N,7-dimethyl-5,6-dihydrocyclopenta[d]pyrimidine-2,4-diamine (PubChem CID 58075739) has the molecular formula C25H26FN7O and a molecular weight of 459.53 g/mol. Its IUPAC name is (7R)-7-(4-fluorophenyl)-2-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N,7-dimethyl-5,6-dihydrocyclopenta[d]pyrimidine-2,4-diamine.
| Compound Name | (7R)-7-(4-fluorophenyl)-2-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N,7-dimethyl-5,6-dihydrocyclopenta[d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58075739 |
| Molecular Formula | C25H26FN7O |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (7R)-7-(4-fluorophenyl)-2-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N,7-dimethyl-5,6-dihydrocyclopenta[d]pyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(-n3cnc(C)n3)c(OC)c2)nc2c1CC[C@]2(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FN7O/c1-15-28-14-33(32-15)20-10-9-18(13-21(20)34-4)29-24-30-22-19(23(27-3)31-24)11-12-25(22,2)16-5-7-17(26)8-6-16/h5-10,13-14H,11-12H2,1-4H3,(H2,27,29,30,31)/t25-/m1/s1 |
| InChIKey | BVRCVYJJLSBRDS-RUZDIDTESA-N |
| XLogP | 4.55 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |