C23H22FN7O — CID 50914815
2-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N-methyl-8-phenyl-6,8-dihydro-5H-pyrano[3,4-d]pyrimidine-2,4-diamine (PubChem CID 50914815) has the molecular formula C23H22FN7O and a molecular weight of 431.48 g/mol. Its IUPAC name is 2-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N-methyl-8-phenyl-6,8-dihydro-5H-pyrano[3,4-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N-methyl-8-phenyl-6,8-dihydro-5H-pyrano[3,4-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 50914815 |
| Molecular Formula | C23H22FN7O |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-4-N-methyl-8-phenyl-6,8-dihydro-5H-pyrano[3,4-d]pyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(-n3cnc(C)n3)c(F)c2)nc2c1CCOC2c1ccccc1 |
| InChI | InChI=1S/C23H22FN7O/c1-14-26-13-31(30-14)19-9-8-16(12-18(19)24)27-23-28-20-17(22(25-2)29-23)10-11-32-21(20)15-6-4-3-5-7-15/h3-9,12-13,21H,10-11H2,1-2H3,(H2,25,27,28,29) |
| InChIKey | OOJJMLRTDXGXSQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |