C26H26FN5O — CID 67325259
8-(4-fluoro-2-methylphenyl)-N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 67325259) has the molecular formula C26H26FN5O and a molecular weight of 443.53 g/mol. Its IUPAC name is 8-(4-fluoro-2-methylphenyl)-N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(4-fluoro-2-methylphenyl)-N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 67325259 |
| Molecular Formula | C26H26FN5O |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 8-(4-fluoro-2-methylphenyl)-N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | COc1cc(Nc2nc3n(n2)CCCC3c2ccc(F)cc2C)ccc1-c1ccnc(C)c1 |
| InChI | InChI=1S/C26H26FN5O/c1-16-13-19(27)6-8-21(16)23-5-4-12-32-25(23)30-26(31-32)29-20-7-9-22(24(15-20)33-3)18-10-11-28-17(2)14-18/h6-11,13-15,23H,4-5,12H2,1-3H3,(H,29,31) |
| InChIKey | OWQJCLMNZXKTCE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |