C25H21F4N5 — CID 67324177
8-[2-fluoro-5-(trifluoromethyl)phenyl]-N-[4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 67324177) has the molecular formula C25H21F4N5 and a molecular weight of 467.47 g/mol. Its IUPAC name is 8-[2-fluoro-5-(trifluoromethyl)phenyl]-N-[4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-[2-fluoro-5-(trifluoromethyl)phenyl]-N-[4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 67324177 |
| Molecular Formula | C25H21F4N5 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 8-[2-fluoro-5-(trifluoromethyl)phenyl]-N-[4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(-c2ccc(Nc3nc4n(n3)CCCC4c3cc(C(F)(F)F)ccc3F)cc2)ccn1 |
| InChI | InChI=1S/C25H21F4N5/c1-15-13-17(10-11-30-15)16-4-7-19(8-5-16)31-24-32-23-20(3-2-12-34(23)33-24)21-14-18(25(27,28)29)6-9-22(21)26/h4-11,13-14,20H,2-3,12H2,1H3,(H,31,33) |
| InChIKey | HLRDBIRVLMGOAN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |