C18H18FN5 — CID 141306433
N-[3-fluoro-4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 141306433) has the molecular formula C18H18FN5 and a molecular weight of 323.38 g/mol. Its IUPAC name is N-[3-fluoro-4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-fluoro-4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 141306433 |
| Molecular Formula | C18H18FN5 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-[3-fluoro-4-(2-methyl-4-pyridinyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(-c2ccc(Nc3nc4n(n3)CCCC4)cc2F)ccn1 |
| InChI | InChI=1S/C18H18FN5/c1-12-10-13(7-8-20-12)15-6-5-14(11-16(15)19)21-18-22-17-4-2-3-9-24(17)23-18/h5-8,10-11H,2-4,9H2,1H3,(H,21,23) |
| InChIKey | OIKDVEAOJPGELZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |