C24H24FN5O — CID 66855889
(8R)-8-(4-fluoro-2-methylphenyl)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 66855889) has the molecular formula C24H24FN5O and a molecular weight of 417.49 g/mol. Its IUPAC name is (8R)-8-(4-fluoro-2-methylphenyl)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | (8R)-8-(4-fluoro-2-methylphenyl)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 66855889 |
| Molecular Formula | C24H24FN5O |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | (8R)-8-(4-fluoro-2-methylphenyl)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(-c2nc3n(n2)CCC[C@@H]3c2ccc(F)cc2C)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H24FN5O/c1-15-11-18(25)7-8-19(15)20-5-4-10-30-24(20)27-23(28-30)17-6-9-21(22(12-17)31-3)29-13-16(2)26-14-29/h6-9,11-14,20H,4-5,10H2,1-3H3/t20-/m1/s1 |
| InChIKey | SZSKTZXFLXPROO-HXUWFJFHSA-N |
| XLogP | 4.82 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |