C24H21F4N5O2 — CID 66857592
8-[2-fluoro-5-(trifluoromethoxy)phenyl]-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 66857592) has the molecular formula C24H21F4N5O2 and a molecular weight of 487.46 g/mol. Its IUPAC name is 8-[2-fluoro-5-(trifluoromethoxy)phenyl]-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-[2-fluoro-5-(trifluoromethoxy)phenyl]-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 66857592 |
| Molecular Formula | C24H21F4N5O2 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 8-[2-fluoro-5-(trifluoromethoxy)phenyl]-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(-c2nc3n(n2)CCCC3c2cc(OC(F)(F)F)ccc2F)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H21F4N5O2/c1-14-12-32(13-29-14)20-8-5-15(10-21(20)34-2)22-30-23-17(4-3-9-33(23)31-22)18-11-16(6-7-19(18)25)35-24(26,27)28/h5-8,10-13,17H,3-4,9H2,1-2H3 |
| InChIKey | QOPWDDBWCWHJDP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |