C26H32O6 — CID 46865343
[(3aR,4R,6R,7E,10Z,11aR)-6-hydroxy-6,10-dimethyl-3-methylidene-2,9-dioxo-3a,4,5,11a-tetrahydrocyclodeca[b]furan-4-yl] adamantane-1-carboxylate (PubChem CID 46865343) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is [(3aR,4R,6R,7E,10Z,11aR)-6-hydroxy-6,10-dimethyl-3-methylidene-2,9-dioxo-3a,4,5,11a-tetrahydrocyclodeca[b]furan-4-yl] adamantane-1-carboxylate.
| Compound Name | [(3aR,4R,6R,7E,10Z,11aR)-6-hydroxy-6,10-dimethyl-3-methylidene-2,9-dioxo-3a,4,5,11a-tetrahydrocyclodeca[b]furan-4-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 46865343 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [(3aR,4R,6R,7E,10Z,11aR)-6-hydroxy-6,10-dimethyl-3-methylidene-2,9-dioxo-3a,4,5,11a-tetrahydrocyclodeca[b]furan-4-yl] adamantane-1-carboxylate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/C)C(=O)/C=C/[C@](C)(O)C[C@@H](OC(=O)C34CC5CC(CC(C5)C3)C4)[C@@H]12 |
| InChI | InChI=1S/C26H32O6/c1-14-6-20-22(15(2)23(28)31-20)21(13-25(3,30)5-4-19(14)27)32-24(29)26-10-16-7-17(11-26)9-18(8-16)12-26/h4-6,16-18,20-22,30H,2,7-13H2,1,3H3/b5-4+,14-6-/t16?,17?,18?,20-,21-,22+,25+,26?/m1/s1 |
| InChIKey | MHXNKTLWEBOWII-FDSBIORLSA-N |
| XLogP | 3.44 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|