C31H34O7 — CID 46865681
(3aR,4R,6R,7E,10Z,11aR)-4,6-bis[(4-methoxyphenyl)methoxy]-6,10-dimethyl-3-methylidene-3a,4,5,11a-tetrahydrocyclodeca[b]furan-2,9-dione (PubChem CID 46865681) has the molecular formula C31H34O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is (3aR,4R,6R,7E,10Z,11aR)-4,6-bis[(4-methoxyphenyl)methoxy]-6,10-dimethyl-3-methylidene-3a,4,5,11a-tetrahydrocyclodeca[b]furan-2,9-dione.
| Compound Name | (3aR,4R,6R,7E,10Z,11aR)-4,6-bis[(4-methoxyphenyl)methoxy]-6,10-dimethyl-3-methylidene-3a,4,5,11a-tetrahydrocyclodeca[b]furan-2,9-dione |
|---|---|
| PubChem CID | 46865681 |
| Molecular Formula | C31H34O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | (3aR,4R,6R,7E,10Z,11aR)-4,6-bis[(4-methoxyphenyl)methoxy]-6,10-dimethyl-3-methylidene-3a,4,5,11a-tetrahydrocyclodeca[b]furan-2,9-dione |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/C)C(=O)/C=C/[C@](C)(OCc3ccc(OC)cc3)C[C@@H](OCc3ccc(OC)cc3)[C@@H]12 |
| InChI | InChI=1S/C31H34O7/c1-20-16-27-29(21(2)30(33)38-27)28(36-18-22-6-10-24(34-4)11-7-22)17-31(3,15-14-26(20)32)37-19-23-8-12-25(35-5)13-9-23/h6-16,27-29H,2,17-19H2,1,3-5H3/b15-14+,20-16-/t27-,28-,29+,31+/m1/s1 |
| InChIKey | RJXPDQMKSDPRGQ-LJZZLXIXSA-N |
| XLogP | 5.14 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|