C40H48N14 — CID 46867167
4-[4-[2,6-bis(1-butyltriazol-4-yl)-4-pyridinyl]phenyl]-2,6-bis(1-butyltriazol-4-yl)pyridine (PubChem CID 46867167) has the molecular formula C40H48N14 and a molecular weight of 724.92 g/mol. Its IUPAC name is 4-[4-[2,6-bis(1-butyltriazol-4-yl)-4-pyridinyl]phenyl]-2,6-bis(1-butyltriazol-4-yl)pyridine.
| Compound Name | 4-[4-[2,6-bis(1-butyltriazol-4-yl)-4-pyridinyl]phenyl]-2,6-bis(1-butyltriazol-4-yl)pyridine |
|---|---|
| PubChem CID | 46867167 |
| Molecular Formula | C40H48N14 |
| Molecular Weight | 724.92 g/mol |
| Exact Mass | 724.42 |
| IUPAC Name | 4-[4-[2,6-bis(1-butyltriazol-4-yl)-4-pyridinyl]phenyl]-2,6-bis(1-butyltriazol-4-yl)pyridine |
| SMILES | CCCCn1cc(-c2cc(-c3ccc(-c4cc(-c5cn(CCCC)nn5)nc(-c5cn(CCCC)nn5)c4)cc3)cc(-c3cn(CCCC)nn3)n2)nn1 |
| InChI | InChI=1S/C40H48N14/c1-5-9-17-51-25-37(43-47-51)33-21-31(22-34(41-33)38-26-52(48-44-38)18-10-6-2)29-13-15-30(16-14-29)32-23-35(39-27-53(49-45-39)19-11-7-3)42-36(24-32)40-28-54(50-46-40)20-12-8-4/h13-16,21-28H,5-12,17-20H2,1-4H3 |
| InChIKey | SPKXZQPIYKRITI-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 148.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.92 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |