C13H15N3OS — CID 4686776
4,4-dimethyl-6-(2-methylprop-2-enylsulfanyl)-2-oxo-1,3-dihydropyridine-3,5-dicarbonitrile (PubChem CID 4686776) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 4,4-dimethyl-6-(2-methylprop-2-enylsulfanyl)-2-oxo-1,3-dihydropyridine-3,5-dicarbonitrile.
| Compound Name | 4,4-dimethyl-6-(2-methylprop-2-enylsulfanyl)-2-oxo-1,3-dihydropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 4686776 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4,4-dimethyl-6-(2-methylprop-2-enylsulfanyl)-2-oxo-1,3-dihydropyridine-3,5-dicarbonitrile |
| SMILES | C=C(C)CSC1=C(C#N)C(C)(C)C(C#N)C(=O)N1 |
| InChI | InChI=1S/C13H15N3OS/c1-8(2)7-18-12-10(6-15)13(3,4)9(5-14)11(17)16-12/h9H,1,7H2,2-4H3,(H,16,17) |
| InChIKey | HEJCRJINNMDJJI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|