C10H9NO5 — CID 46868566
1-(2-carboxyprop-2-enyl)-2-oxopyridine-4-carboxylic acid (PubChem CID 46868566) has the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. Its IUPAC name is 1-(2-carboxyprop-2-enyl)-2-oxopyridine-4-carboxylic acid.
| Compound Name | 1-(2-carboxyprop-2-enyl)-2-oxopyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 46868566 |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1-(2-carboxyprop-2-enyl)-2-oxopyridine-4-carboxylic acid |
| SMILES | C=C(Cn1ccc(C(=O)O)cc1=O)C(=O)O |
| InChI | InChI=1S/C10H9NO5/c1-6(9(13)14)5-11-3-2-7(10(15)16)4-8(11)12/h2-4H,1,5H2,(H,13,14)(H,15,16) |
| InChIKey | XIQFHPOQCBDMRR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|