C9H8ClNO3 — CID 82903725
1-(2-chloroprop-2-enyl)-2-oxopyridine-4-carboxylic acid (PubChem CID 82903725) has the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. Its IUPAC name is 1-(2-chloroprop-2-enyl)-2-oxopyridine-4-carboxylic acid.
| Compound Name | 1-(2-chloroprop-2-enyl)-2-oxopyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 82903725 |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 1-(2-chloroprop-2-enyl)-2-oxopyridine-4-carboxylic acid |
| SMILES | C=C(Cl)Cn1ccc(C(=O)O)cc1=O |
| InChI | InChI=1S/C9H8ClNO3/c1-6(10)5-11-3-2-7(9(13)14)4-8(11)12/h2-4H,1,5H2,(H,13,14) |
| InChIKey | OKWRPSCESTXFFT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |