C27H23F6N5O4 — CID 46869002
(3R)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;1-hydroxynaphthalene-2-carboxylic acid (PubChem CID 46869002) has the molecular formula C27H23F6N5O4 and a molecular weight of 595.50 g/mol. Its IUPAC name is (3R)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;1-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | (3R)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;1-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 46869002 |
| Molecular Formula | C27H23F6N5O4 |
| Molecular Weight | 595.50 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | (3R)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;1-hydroxynaphthalene-2-carboxylic acid |
| SMILES | N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F.O=C(O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C16H15F6N5O.C11H8O3/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22;12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h4,6,9H,1-3,5,7,23H2;1-6,12H,(H,13,14)/t9-;/m1./s1 |
| InChIKey | XJASDXMNLNFDLD-SBSPUUFOSA-N |
| XLogP | 4.26 |
| TPSA | 134.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|