C16H18F6N5O5P — CID 75086476
Rac-Sitagliptin Phosphate (PubChem CID 75086476) has the molecular formula C16H18F6N5O5P and a molecular weight of 505.31 g/mol.
| Compound Name | Rac-Sitagliptin Phosphate |
|---|---|
| PubChem CID | 75086476 |
| Molecular Formula | C16H18F6N5O5P |
| Molecular Weight | 505.31 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | — |
| SMILES | NC(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F.O=P(=O)OO.[H][H] |
| InChI | InChI=1S/C16H15F6N5O.HO4P.H2/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22;1-4-5(2)3;/h4,6,9H,1-3,5,7,23H2;1H;1H |
| InChIKey | SHWZYHNHAUKDOV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|