C19H20ClN5O2 — CID 46869453
4-[[1-(3-chlorophenyl)-2-(methylamino)ethyl]amino]-6-methoxyquinazoline-8-carboxamide (PubChem CID 46869453) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is 4-[[1-(3-chlorophenyl)-2-(methylamino)ethyl]amino]-6-methoxyquinazoline-8-carboxamide.
| Compound Name | 4-[[1-(3-chlorophenyl)-2-(methylamino)ethyl]amino]-6-methoxyquinazoline-8-carboxamide |
|---|---|
| PubChem CID | 46869453 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-[[1-(3-chlorophenyl)-2-(methylamino)ethyl]amino]-6-methoxyquinazoline-8-carboxamide |
| SMILES | CNCC(Nc1ncnc2c(C(N)=O)cc(OC)cc12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClN5O2/c1-22-9-16(11-4-3-5-12(20)6-11)25-19-15-8-13(27-2)7-14(18(21)26)17(15)23-10-24-19/h3-8,10,16,22H,9H2,1-2H3,(H2,21,26)(H,23,24,25) |
| InChIKey | KTEVQEUEMLYYMP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |