C22H26N6 — CID 46870858
5-cyclobutyl-15-pyrimidin-2-yl-2,5,9,15-tetrazatetracyclo[8.8.0.02,8.012,17]octadeca-1(10),8,11,17-tetraene (PubChem CID 46870858) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-cyclobutyl-15-pyrimidin-2-yl-2,5,9,15-tetrazatetracyclo[8.8.0.02,8.012,17]octadeca-1(10),8,11,17-tetraene.
| Compound Name | 5-cyclobutyl-15-pyrimidin-2-yl-2,5,9,15-tetrazatetracyclo[8.8.0.02,8.012,17]octadeca-1(10),8,11,17-tetraene |
|---|---|
| PubChem CID | 46870858 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 5-cyclobutyl-15-pyrimidin-2-yl-2,5,9,15-tetrazatetracyclo[8.8.0.02,8.012,17]octadeca-1(10),8,11,17-tetraene |
| SMILES | c1cnc(N2CCc3cc4nc5n(c4cc3C2)CCN(C2CCC2)CC5)nc1 |
| InChI | InChI=1S/C22H26N6/c1-3-18(4-1)26-10-6-21-25-19-13-16-5-9-27(22-23-7-2-8-24-22)15-17(16)14-20(19)28(21)12-11-26/h2,7-8,13-14,18H,1,3-6,9-12,15H2 |
| InChIKey | KOLZELIWRXGEJH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |