C20H26N4O — CID 46870859
1-(5-cyclobutyl-2,5,9,15-tetrazatetracyclo[8.8.0.02,8.012,17]octadeca-1(10),8,11,17-tetraen-15-yl)ethanone (PubChem CID 46870859) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-(5-cyclobutyl-2,5,9,15-tetrazatetracyclo[8.8.0.02,8.012,17]octadeca-1(10),8,11,17-tetraen-15-yl)ethanone.
| Compound Name | 1-(5-cyclobutyl-2,5,9,15-tetrazatetracyclo[8.8.0.02,8.012,17]octadeca-1(10),8,11,17-tetraen-15-yl)ethanone |
|---|---|
| PubChem CID | 46870859 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-(5-cyclobutyl-2,5,9,15-tetrazatetracyclo[8.8.0.02,8.012,17]octadeca-1(10),8,11,17-tetraen-15-yl)ethanone |
| SMILES | CC(=O)N1CCc2cc3nc4n(c3cc2C1)CCN(C1CCC1)CC4 |
| InChI | InChI=1S/C20H26N4O/c1-14(25)23-7-5-15-11-18-19(12-16(15)13-23)24-10-9-22(17-3-2-4-17)8-6-20(24)21-18/h11-12,17H,2-10,13H2,1H3 |
| InChIKey | ABVQWXFMIFHYPZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |