C19H24N2O9 — CID 46873148
methyl 6-methyl-2-oxo-4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 46873148) has the molecular formula C19H24N2O9 and a molecular weight of 424.41 g/mol. Its IUPAC name is methyl 6-methyl-2-oxo-4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 6-methyl-2-oxo-4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 46873148 |
| Molecular Formula | C19H24N2O9 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | methyl 6-methyl-2-oxo-4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=O)NC1c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C19H24N2O9/c1-8-12(17(26)28-2)13(21-19(27)20-8)9-3-5-10(6-4-9)29-18-16(25)15(24)14(23)11(7-22)30-18/h3-6,11,13-16,18,22-25H,7H2,1-2H3,(H2,20,21,27)/t11-,13?,14-,15-,16-,18-/m1/s1 |
| InChIKey | SNSGQUOOHFVNOK-IUDQRHHLSA-N |
| XLogP | -1.33 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |