C29H30N2O6 — CID 46873302
N-[7-[2-(dimethylamino)ethoxy]-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 46873302) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is N-[7-[2-(dimethylamino)ethoxy]-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[7-[2-(dimethylamino)ethoxy]-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 46873302 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | N-[7-[2-(dimethylamino)ethoxy]-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc(OCCN(C)C)c(C)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C29H30N2O6/c1-18-25(36-14-13-31(2)3)11-9-20-17-24(29(33)37-27(18)20)30-28(32)21-10-12-26(35-5)23(16-21)19-7-6-8-22(15-19)34-4/h6-12,15-17H,13-14H2,1-5H3,(H,30,32) |
| InChIKey | DJNFXDVLZICZSZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|