C34H42N2O5 — CID 10507720
[3-[[methyl-[5-(9-oxoxanthen-3-yl)oxypentyl]amino]methyl]phenyl] N-heptylcarbamate (PubChem CID 10507720) has the molecular formula C34H42N2O5 and a molecular weight of 558.72 g/mol. Its IUPAC name is [3-[[methyl-[5-(9-oxoxanthen-3-yl)oxypentyl]amino]methyl]phenyl] N-heptylcarbamate.
| Compound Name | [3-[[methyl-[5-(9-oxoxanthen-3-yl)oxypentyl]amino]methyl]phenyl] N-heptylcarbamate |
|---|---|
| PubChem CID | 10507720 |
| Molecular Formula | C34H42N2O5 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | [3-[[methyl-[5-(9-oxoxanthen-3-yl)oxypentyl]amino]methyl]phenyl] N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)Oc1cccc(CN(C)CCCCCOc2ccc3c(=O)c4ccccc4oc3c2)c1 |
| InChI | InChI=1S/C34H42N2O5/c1-3-4-5-6-10-20-35-34(38)40-28-15-13-14-26(23-28)25-36(2)21-11-7-12-22-39-27-18-19-30-32(24-27)41-31-17-9-8-16-29(31)33(30)37/h8-9,13-19,23-24H,3-7,10-12,20-22,25H2,1-2H3,(H,35,38) |
| InChIKey | CWUHTFLRVKGIBR-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|