C35H33ClFN9O — CID 46879193
4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-(4-ethylpiperazin-1-yl)-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 46879193) has the molecular formula C35H33ClFN9O and a molecular weight of 650.16 g/mol. Its IUPAC name is 4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-(4-ethylpiperazin-1-yl)-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-(4-ethylpiperazin-1-yl)-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46879193 |
| Molecular Formula | C35H33ClFN9O |
| Molecular Weight | 650.16 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | 4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-(4-ethylpiperazin-1-yl)-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN1CCN(c2nc(Nc3ccc(F)cc3)nc(Nc3ccc(Nc4c5ccc(Cl)cc5nc5ccc(OC)cc45)cc3)n2)CC1 |
| InChI | InChI=1S/C35H33ClFN9O/c1-3-45-16-18-46(19-17-45)35-43-33(39-25-7-5-23(37)6-8-25)42-34(44-35)40-26-11-9-24(10-12-26)38-32-28-14-4-22(36)20-31(28)41-30-15-13-27(47-2)21-29(30)32/h4-15,20-21H,3,16-19H2,1-2H3,(H,38,41)(H2,39,40,42,43,44) |
| InChIKey | GQOHPMBUPYHDSZ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.16 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|