C33H31ClFN9O — CID 46879194
4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(dimethylamino)ethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 46879194) has the molecular formula C33H31ClFN9O and a molecular weight of 624.12 g/mol. Its IUPAC name is 4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(dimethylamino)ethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(dimethylamino)ethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46879194 |
| Molecular Formula | C33H31ClFN9O |
| Molecular Weight | 624.12 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(dimethylamino)ethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(Nc4nc(NCCN(C)C)nc(Nc5ccc(F)cc5)n4)cc3)c2c1 |
| InChI | InChI=1S/C33H31ClFN9O/c1-44(2)17-16-36-31-41-32(38-23-7-5-21(35)6-8-23)43-33(42-31)39-24-11-9-22(10-12-24)37-30-26-14-4-20(34)18-29(26)40-28-15-13-25(45-3)19-27(28)30/h4-15,18-19H,16-17H2,1-3H3,(H,37,40)(H3,36,38,39,41,42,43) |
| InChIKey | GMSIIPQALCIBFL-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.12 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|