C29H40N6O5 — CID 46879330
N-[(2S,3S)-1-[[(2R)-1-[[(2S)-5-amino-1-hydrazinyl-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-phenylbenzamide (PubChem CID 46879330) has the molecular formula C29H40N6O5 and a molecular weight of 552.68 g/mol. Its IUPAC name is N-[(2S,3S)-1-[[(2R)-1-[[(2S)-5-amino-1-hydrazinyl-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[(2S,3S)-1-[[(2R)-1-[[(2S)-5-amino-1-hydrazinyl-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 46879330 |
| Molecular Formula | C29H40N6O5 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | N-[(2S,3S)-1-[[(2R)-1-[[(2S)-5-amino-1-hydrazinyl-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-phenylbenzamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccc(-c2ccccc2)cc1)C(=O)N[C@@H](C(=O)N[C@@H](CCC(N)=O)C(=O)NN)C(C)C |
| InChI | InChI=1S/C29H40N6O5/c1-5-18(4)25(34-26(37)21-13-11-20(12-14-21)19-9-7-6-8-10-19)29(40)33-24(17(2)3)28(39)32-22(27(38)35-31)15-16-23(30)36/h6-14,17-18,22,24-25H,5,15-16,31H2,1-4H3,(H2,30,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38)/t18-,22-,24+,25-/m0/s1 |
| InChIKey | NDCNZTGPFCZRKZ-VVYCWGTDSA-N |
| XLogP | 1.38 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|