C17H15ClN6O2 — CID 46880193
2-(6-chlorobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one (PubChem CID 46880193) has the molecular formula C17H15ClN6O2 and a molecular weight of 370.80 g/mol. Its IUPAC name is 2-(6-chlorobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one.
| Compound Name | 2-(6-chlorobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 46880193 |
| Molecular Formula | C17H15ClN6O2 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-(6-chlorobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(-n3cnc4ccc(Cl)cc43)nc2n1C1CCOCC1 |
| InChI | InChI=1S/C17H15ClN6O2/c18-10-1-2-12-14(7-10)23(9-20-12)16-19-8-13-15(22-16)24(17(25)21-13)11-3-5-26-6-4-11/h1-2,7-9,11H,3-6H2,(H,21,25) |
| InChIKey | AVUNZQVPUJFUDR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |