C38H32FN3O5S — CID 4688039
6-(3-fluoro-2-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4688039) has the molecular formula C38H32FN3O5S and a molecular weight of 661.76 g/mol. Its IUPAC name is 6-(3-fluoro-2-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(3-fluoro-2-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4688039 |
| Molecular Formula | C38H32FN3O5S |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | 6-(3-fluoro-2-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)N(Cc6cccs6)C(=O)C54)C(c4cccc(F)c4O)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C38H32FN3O5S/c1-21-12-14-23(15-13-21)40-42-35(45)29-19-28-25(16-17-26-31(28)36(46)41(34(26)44)20-24-9-6-18-48-24)32(27-10-5-11-30(39)33(27)43)38(29,37(42)47)22-7-3-2-4-8-22/h2-16,18,26,28-29,31-32,40,43H,17,19-20H2,1H3 |
| InChIKey | ZYFZDBLOYHPRHP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|