C23H28N2O3 — CID 46880522
(NE)-N-[2,4-bis(3-methoxyphenyl)-1-methyl-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine (PubChem CID 46880522) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is (NE)-N-[2,4-bis(3-methoxyphenyl)-1-methyl-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[2,4-bis(3-methoxyphenyl)-1-methyl-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 46880522 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (NE)-N-[2,4-bis(3-methoxyphenyl)-1-methyl-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine |
| SMILES | COc1cccc(C2NC(c3cccc(OC)c3)C3(C)CCCC2/C3=N\O)c1 |
| InChI | InChI=1S/C23H28N2O3/c1-23-12-6-11-19(22(23)25-26)20(15-7-4-9-17(13-15)27-2)24-21(23)16-8-5-10-18(14-16)28-3/h4-5,7-10,13-14,19-21,24,26H,6,11-12H2,1-3H3/b25-22+ |
| InChIKey | KXJPOZONBNJYPY-YYDJUVGSSA-N |
| XLogP | 4.73 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|