C19H18F2N2O2S — CID 46880658
5-fluoro-3-(3-fluorophenyl)sulfonyl-1-(1-methylpyrrolidin-3-yl)indole (PubChem CID 46880658) has the molecular formula C19H18F2N2O2S and a molecular weight of 376.43 g/mol. Its IUPAC name is 5-fluoro-3-(3-fluorophenyl)sulfonyl-1-(1-methylpyrrolidin-3-yl)indole.
| Compound Name | 5-fluoro-3-(3-fluorophenyl)sulfonyl-1-(1-methylpyrrolidin-3-yl)indole |
|---|---|
| PubChem CID | 46880658 |
| Molecular Formula | C19H18F2N2O2S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 5-fluoro-3-(3-fluorophenyl)sulfonyl-1-(1-methylpyrrolidin-3-yl)indole |
| SMILES | CN1CCC(n2cc(S(=O)(=O)c3cccc(F)c3)c3cc(F)ccc32)C1 |
| InChI | InChI=1S/C19H18F2N2O2S/c1-22-8-7-15(11-22)23-12-19(17-10-14(21)5-6-18(17)23)26(24,25)16-4-2-3-13(20)9-16/h2-6,9-10,12,15H,7-8,11H2,1H3 |
| InChIKey | VQKUYLJQGPKXQK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |