C24H26F2N4 — CID 168939750
4-fluoro-1-(1-methylazetidin-3-yl)indole;6-fluoro-1-(1-methylazetidin-3-yl)indole (PubChem CID 168939750) has the molecular formula C24H26F2N4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-fluoro-1-(1-methylazetidin-3-yl)indole;6-fluoro-1-(1-methylazetidin-3-yl)indole.
| Compound Name | 4-fluoro-1-(1-methylazetidin-3-yl)indole;6-fluoro-1-(1-methylazetidin-3-yl)indole |
|---|---|
| PubChem CID | 168939750 |
| Molecular Formula | C24H26F2N4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 4-fluoro-1-(1-methylazetidin-3-yl)indole;6-fluoro-1-(1-methylazetidin-3-yl)indole |
| SMILES | CN1CC(n2ccc3c(F)cccc32)C1.CN1CC(n2ccc3ccc(F)cc32)C1 |
| InChI | InChI=1S/2C12H13FN2/c1-14-7-11(8-14)15-5-4-9-2-3-10(13)6-12(9)15;1-14-7-9(8-14)15-6-5-10-11(13)3-2-4-12(10)15/h2-6,11H,7-8H2,1H3;2-6,9H,7-8H2,1H3 |
| InChIKey | ZJJSFJDHKKNXNE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 16.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |