C21H24BrFN2 — CID 174406015
6-bromo-1-(1-ethylpiperidin-4-yl)indole;fluorobenzene (PubChem CID 174406015) has the molecular formula C21H24BrFN2 and a molecular weight of 403.34 g/mol. Its IUPAC name is 6-bromo-1-(1-ethylpiperidin-4-yl)indole;fluorobenzene.
| Compound Name | 6-bromo-1-(1-ethylpiperidin-4-yl)indole;fluorobenzene |
|---|---|
| PubChem CID | 174406015 |
| Molecular Formula | C21H24BrFN2 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 6-bromo-1-(1-ethylpiperidin-4-yl)indole;fluorobenzene |
| SMILES | CCN1CCC(n2ccc3ccc(Br)cc32)CC1.Fc1ccccc1 |
| InChI | InChI=1S/C15H19BrN2.C6H5F/c1-2-17-8-6-14(7-9-17)18-10-5-12-3-4-13(16)11-15(12)18;7-6-4-2-1-3-5-6/h3-5,10-11,14H,2,6-9H2,1H3;1-5H |
| InChIKey | PDPMDMZZPSJTMR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |