C18H24N2O2 — CID 174406031
3-[1-(1-ethylpiperidin-4-yl)indol-6-yl]propanoic acid (PubChem CID 174406031) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-[1-(1-ethylpiperidin-4-yl)indol-6-yl]propanoic acid.
| Compound Name | 3-[1-(1-ethylpiperidin-4-yl)indol-6-yl]propanoic acid |
|---|---|
| PubChem CID | 174406031 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-[1-(1-ethylpiperidin-4-yl)indol-6-yl]propanoic acid |
| SMILES | CCN1CCC(n2ccc3ccc(CCC(=O)O)cc32)CC1 |
| InChI | InChI=1S/C18H24N2O2/c1-2-19-10-8-16(9-11-19)20-12-7-15-5-3-14(13-17(15)20)4-6-18(21)22/h3,5,7,12-13,16H,2,4,6,8-11H2,1H3,(H,21,22) |
| InChIKey | KGKBZVBLGXPRKD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |