C25H27FN4O — CID 87903495
N-cyano-2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-6-yl]-N-methylacetamide (PubChem CID 87903495) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is N-cyano-2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-6-yl]-N-methylacetamide.
| Compound Name | N-cyano-2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-6-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 87903495 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-cyano-2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-6-yl]-N-methylacetamide |
| SMILES | CN(C#N)C(=O)Cc1ccc2ccn(C3CCN(CCc4ccc(F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C25H27FN4O/c1-28(18-27)25(31)17-20-2-5-21-9-15-30(24(21)16-20)23-10-13-29(14-11-23)12-8-19-3-6-22(26)7-4-19/h2-7,9,15-16,23H,8,10-14,17H2,1H3 |
| InChIKey | USTQPCDYAZBFFI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|