C31H33FN4O5 — CID 22038162
2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-6-yl]-N-(pyridin-2-ylmethyl)acetamide;oxalic acid (PubChem CID 22038162) has the molecular formula C31H33FN4O5 and a molecular weight of 560.63 g/mol. Its IUPAC name is 2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-6-yl]-N-(pyridin-2-ylmethyl)acetamide;oxalic acid.
| Compound Name | 2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-6-yl]-N-(pyridin-2-ylmethyl)acetamide;oxalic acid |
|---|---|
| PubChem CID | 22038162 |
| Molecular Formula | C31H33FN4O5 |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-6-yl]-N-(pyridin-2-ylmethyl)acetamide;oxalic acid |
| SMILES | O=C(Cc1ccc2ccn(C3CCN(CCc4ccc(F)cc4)CC3)c2c1)NCc1ccccn1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H31FN4O.C2H2O4/c30-25-8-5-22(6-9-25)10-15-33-16-12-27(13-17-33)34-18-11-24-7-4-23(19-28(24)34)20-29(35)32-21-26-3-1-2-14-31-26;3-1(4)2(5)6/h1-9,11,14,18-19,27H,10,12-13,15-17,20-21H2,(H,32,35);(H,3,4)(H,5,6) |
| InChIKey | WSXCZXXQJOYJMT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|