C62H64F2N8O6 — CID 87903482
bis[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-6-[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]indol-3-yl] oxalate (PubChem CID 87903482) has the molecular formula C62H64F2N8O6 and a molecular weight of 1055.24 g/mol. Its IUPAC name is bis[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-6-[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]indol-3-yl] oxalate.
| Compound Name | bis[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-6-[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]indol-3-yl] oxalate |
|---|---|
| PubChem CID | 87903482 |
| Molecular Formula | C62H64F2N8O6 |
| Molecular Weight | 1055.24 g/mol |
| Exact Mass | 1054.49 |
| IUPAC Name | bis[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-6-[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]indol-3-yl] oxalate |
| SMILES | O=C(Cc1ccc2c(OC(=O)C(=O)Oc3cn(C4CCN(CCc5ccc(F)cc5)CC4)c4cc(CC(=O)NCCc5ccccn5)ccc34)cn(C3CCN(CCc4ccc(F)cc4)CC3)c2c1)NCCc1ccccn1 |
| InChI | InChI=1S/C62H64F2N8O6/c63-47-13-7-43(8-14-47)21-31-69-33-23-51(24-34-69)71-41-57(53-17-11-45(37-55(53)71)39-59(73)67-29-19-49-5-1-3-27-65-49)77-61(75)62(76)78-58-42-72(52-25-35-70(36-26-52)32-22-44-9-15-48(64)16-10-44)56-38-46(12-18-54(56)58)40-60(74)68-30-20-50-6-2-4-28-66-50/h1-18,27-28,37-38,41-42,51-52H,19-26,29-36,39-40H2,(H,67,73)(H,68,74) |
| InChIKey | BDWKXVASIAVXTQ-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 152.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1055.24 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|