C64H80F2N8O6 — CID 87903484
bis[6-[2-[(1-ethylpiperidin-4-yl)methylamino]-2-oxoethyl]-1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-3-yl] oxalate (PubChem CID 87903484) has the molecular formula C64H80F2N8O6 and a molecular weight of 1095.39 g/mol. Its IUPAC name is bis[6-[2-[(1-ethylpiperidin-4-yl)methylamino]-2-oxoethyl]-1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-3-yl] oxalate.
| Compound Name | bis[6-[2-[(1-ethylpiperidin-4-yl)methylamino]-2-oxoethyl]-1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-3-yl] oxalate |
|---|---|
| PubChem CID | 87903484 |
| Molecular Formula | C64H80F2N8O6 |
| Molecular Weight | 1095.39 g/mol |
| Exact Mass | 1094.62 |
| IUPAC Name | bis[6-[2-[(1-ethylpiperidin-4-yl)methylamino]-2-oxoethyl]-1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]indol-3-yl] oxalate |
| SMILES | CCN1CCC(CNC(=O)Cc2ccc3c(OC(=O)C(=O)Oc4cn(C5CCN(CCc6ccc(F)cc6)CC5)c5cc(CC(=O)NCC6CCN(CC)CC6)ccc45)cn(C4CCN(CCc5ccc(F)cc5)CC4)c3c2)CC1 |
| InChI | InChI=1S/C64H80F2N8O6/c1-3-69-27-19-47(20-28-69)41-67-61(75)39-49-9-15-55-57(37-49)73(53-23-33-71(34-24-53)31-17-45-5-11-51(65)12-6-45)43-59(55)79-63(77)64(78)80-60-44-74(54-25-35-72(36-26-54)32-18-46-7-13-52(66)14-8-46)58-38-50(10-16-56(58)60)40-62(76)68-42-48-21-29-70(4-2)30-22-48/h5-16,37-38,43-44,47-48,53-54H,3-4,17-36,39-42H2,1-2H3,(H,67,75)(H,68,76) |
| InChIKey | LPYXDHINMYKZQF-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.39 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|