C21H25FN2O — CID 95302178
2-(3-fluorophenyl)-N-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide (PubChem CID 95302178) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 95302178 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide |
| SMILES | O=C(Cc1cccc(F)c1)NC[C@@H]1CCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C21H25FN2O/c22-20-8-4-7-18(13-20)14-21(25)23-15-19-10-12-24(16-19)11-9-17-5-2-1-3-6-17/h1-8,13,19H,9-12,14-16H2,(H,23,25)/t19-/m0/s1 |
| InChIKey | XFQTZSZIXSQPKB-IBGZPJMESA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |