C25H28N2O2 — CID 97185415
2-naphthalen-2-yloxy-N-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide (PubChem CID 97185415) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-naphthalen-2-yloxy-N-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide.
| Compound Name | 2-naphthalen-2-yloxy-N-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97185415 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-naphthalen-2-yloxy-N-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide |
| SMILES | O=C(COc1ccc2ccccc2c1)NC[C@@H]1CCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C25H28N2O2/c28-25(19-29-24-11-10-22-8-4-5-9-23(22)16-24)26-17-21-13-15-27(18-21)14-12-20-6-2-1-3-7-20/h1-11,16,21H,12-15,17-19H2,(H,26,28)/t21-/m0/s1 |
| InChIKey | QCCSIICVWFQTFZ-NRFANRHFSA-N |
| XLogP | 3.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |