C25H27FN4O — CID 22037937
N-[3-cyano-1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2-methylindol-6-yl]acetamide (PubChem CID 22037937) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[3-cyano-1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2-methylindol-6-yl]acetamide.
| Compound Name | N-[3-cyano-1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2-methylindol-6-yl]acetamide |
|---|---|
| PubChem CID | 22037937 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[3-cyano-1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2-methylindol-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(C#N)c(C)n(C3CCN(CCc4ccc(F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C25H27FN4O/c1-17-24(16-27)23-8-7-21(28-18(2)31)15-25(23)30(17)22-10-13-29(14-11-22)12-9-19-3-5-20(26)6-4-19/h3-8,15,22H,9-14H2,1-2H3,(H,28,31) |
| InChIKey | GAURXIFROVOMTA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |