C24H29FN4O2 — CID 87903544
N-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-3-hydroxyimino-2-methyl-2H-indol-6-yl]acetamide (PubChem CID 87903544) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-3-hydroxyimino-2-methyl-2H-indol-6-yl]acetamide.
| Compound Name | N-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-3-hydroxyimino-2-methyl-2H-indol-6-yl]acetamide |
|---|---|
| PubChem CID | 87903544 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-3-hydroxyimino-2-methyl-2H-indol-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)N(C1CCN(CCc3ccc(F)cc3)CC1)C(C)C2=NO |
| InChI | InChI=1S/C24H29FN4O2/c1-16-24(27-31)22-8-7-20(26-17(2)30)15-23(22)29(16)21-10-13-28(14-11-21)12-9-18-3-5-19(25)6-4-18/h3-8,15-16,21,31H,9-14H2,1-2H3,(H,26,30) |
| InChIKey | QNOUNHBLNJXRQL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|