C22H23N5 — CID 18796598
1-(1-benzylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indole (PubChem CID 18796598) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indole.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indole |
|---|---|
| PubChem CID | 18796598 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indole |
| SMILES | c1ccc(CN2CCC(n3ccc4ccc(-n5cnnc5)cc43)CC2)cc1 |
| InChI | InChI=1S/C22H23N5/c1-2-4-18(5-3-1)15-25-11-9-20(10-12-25)27-13-8-19-6-7-21(14-22(19)27)26-16-23-24-17-26/h1-8,13-14,16-17,20H,9-12,15H2 |
| InChIKey | LSMBIYJOXNNNPU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |