C16H17N3 — CID 46881453
4-(3,4-dimethylphenyl)-6-propylpyrimidine-2-carbonitrile (PubChem CID 46881453) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-6-propylpyrimidine-2-carbonitrile.
| Compound Name | 4-(3,4-dimethylphenyl)-6-propylpyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 46881453 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-6-propylpyrimidine-2-carbonitrile |
| SMILES | CCCc1cc(-c2ccc(C)c(C)c2)nc(C#N)n1 |
| InChI | InChI=1S/C16H17N3/c1-4-5-14-9-15(19-16(10-17)18-14)13-7-6-11(2)12(3)8-13/h6-9H,4-5H2,1-3H3 |
| InChIKey | DQIASLCZULZUNM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |