C26H30N4O2 — CID 46881902
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 46881902) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 46881902 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1)c1ccccc1N1CCCC1 |
| InChI | InChI=1S/C26H30N4O2/c31-25(21-6-5-14-27-18-21)19-28-15-13-20-9-11-22(12-10-20)29-26(32)23-7-1-2-8-24(23)30-16-3-4-17-30/h1-2,5-12,14,18,25,28,31H,3-4,13,15-17,19H2,(H,29,32)/t25-/m0/s1 |
| InChIKey | OAFWFJPMALLJIG-VWLOTQADSA-N |
| XLogP | 3.80 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|