C11H19N3O5S — CID 46882732
(3S)-4-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid (PubChem CID 46882732) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is (3S)-4-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid.
| Compound Name | (3S)-4-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 46882732 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (3S)-4-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)[C@H](CC(=O)O)NC(=O)CS)C(N)=O |
| InChI | InChI=1S/C11H19N3O5S/c1-5(2)9(10(12)18)14-11(19)6(3-8(16)17)13-7(15)4-20/h5-6,9,20H,3-4H2,1-2H3,(H2,12,18)(H,13,15)(H,14,19)(H,16,17)/t6-,9?/m0/s1 |
| InChIKey | CEITZPMXLZGMEI-AADKRJSRSA-N |
| XLogP | -1.50 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|