C17H22O7 — CID 46882749
(2R,3R,4S,5S,6R)-2-[(4-buta-2,3-dienoxyphenyl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46882749) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(4-buta-2,3-dienoxyphenyl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(4-buta-2,3-dienoxyphenyl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46882749 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(4-buta-2,3-dienoxyphenyl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=C=CCOc1ccc(CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C17H22O7/c1-2-3-8-22-12-6-4-11(5-7-12)10-23-17-16(21)15(20)14(19)13(9-18)24-17/h3-7,13-21H,1,8-10H2/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | PLHYONMLZLAVMD-NQNKBUKLSA-N |
| XLogP | -0.28 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |