C23H30N4O3 — CID 46882831
N-[1-[(4-amino-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1,3-benzoxazol-2-amine (PubChem CID 46882831) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[1-[(4-amino-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[1-[(4-amino-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 46882831 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-[1-[(4-amino-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1,3-benzoxazol-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3nc4ccccc4o3)CC2)cc(OCC)c1N |
| InChI | InChI=1S/C23H30N4O3/c1-3-28-20-13-16(14-21(22(20)24)29-4-2)15-27-11-9-17(10-12-27)25-23-26-18-7-5-6-8-19(18)30-23/h5-8,13-14,17H,3-4,9-12,15,24H2,1-2H3,(H,25,26) |
| InChIKey | BKXYGWGAVWDKTL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|