C33H52O4 — CID 46882894
(4aS,6aR,6aS,6bR,8aS,11S,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-11-propanoyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid (PubChem CID 46882894) has the molecular formula C33H52O4 and a molecular weight of 512.78 g/mol. Its IUPAC name is (4aS,6aR,6aS,6bR,8aS,11S,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-11-propanoyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid.
| Compound Name | (4aS,6aR,6aS,6bR,8aS,11S,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-11-propanoyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 46882894 |
| Molecular Formula | C33H52O4 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | (4aS,6aR,6aS,6bR,8aS,11S,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-11-propanoyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES | CCC(=O)O[C@H]1CC(C)(C)[C@@H]2CC[C@]3(C)[C@H](CC=C4[C@@H]5CC(C)(C)CC[C@]5(C(=O)O)CC[C@]43C)[C@@]2(C)C1 |
| InChI | InChI=1S/C33H52O4/c1-9-26(34)37-21-18-29(4,5)24-12-13-32(8)25(30(24,6)19-21)11-10-22-23-20-28(2,3)14-16-33(23,27(35)36)17-15-31(22,32)7/h10,21,23-25H,9,11-20H2,1-8H3,(H,35,36)/t21-,23-,24-,25+,30-,31+,32+,33-/m0/s1 |
| InChIKey | XXRVGHCVSNPWSY-NMERAVNKSA-N |
| XLogP | 8.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|