C19H24N6OS — CID 46883173
(4R)-3-[2-[amino-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]amino]acetyl]-1,3-thiazolidine-4-carbonitrile (PubChem CID 46883173) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is (4R)-3-[2-[amino-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]amino]acetyl]-1,3-thiazolidine-4-carbonitrile.
| Compound Name | (4R)-3-[2-[amino-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]amino]acetyl]-1,3-thiazolidine-4-carbonitrile |
|---|---|
| PubChem CID | 46883173 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (4R)-3-[2-[amino-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]amino]acetyl]-1,3-thiazolidine-4-carbonitrile |
| SMILES | N#Cc1ccc(CN2CCC(N(N)CC(=O)N3CSC[C@H]3C#N)CC2)cc1 |
| InChI | InChI=1S/C19H24N6OS/c20-9-15-1-3-16(4-2-15)11-23-7-5-17(6-8-23)25(22)12-19(26)24-14-27-13-18(24)10-21/h1-4,17-18H,5-8,11-14,22H2/t18-/m1/s1 |
| InChIKey | STLLRHZNTBKRKV-GOSISDBHSA-N |
| XLogP | 1.12 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|